4712-55-4 Diphenyl phosphite
اسم المنتج |
Diphenyl phosphite |
الاسم بالانجليزية |
Diphenyl phosphite; diphenyl phosphonate; Phosphonic acid diphenyl ester; diphenyl hydrogen phosphite; oxo(diphenoxy)phosphonium |
الصيغة الجزيئية |
C12H11O3P |
الوزن الجزيئي الغرامي |
234.1877 |
InChI |
InChI=1/C12H11O3P/c13-16(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10,16H |
إستراتيجية المساعدة القطرية |
4712-55-4 |
المفوضية الأوروبية رقم |
225-202-8 |
بنية جزيئية |
|
درجة الإنصهار |
12℃ |
نقطة الغليان |
348.233°C at 760 mmHg |
نقطة الوميض |
178.834°C |
ضغط البخار |
0mmHg at 25°C |
علامات على البضائع الخطرة |
C:Corrosive;
|
خطر المصطلحات |
R34:Causes burns.;
|
شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|
|