ChemNet > CAS > 4792-58-9 5-methoxyindole-2-carboxylic acid ethyl ester
4792-58-9 5-methoxyindole-2-carboxylic acid ethyl ester
اسم المنتج |
5-methoxyindole-2-carboxylic acid ethyl ester |
الاسم بالانجليزية |
5-methoxyindole-2-carboxylic acid ethyl ester; 1H-Indole-2-carboxylic acid, 5-methoxy-, ethyl ester; 1H-Indole-2-carboxylic acid, 5-methoxy-, ethyl ester; 5-22-05-00181 (Beilstein Handbook Reference); Ethyl 5-methoxy-1H-indole-2-carboxylate; Methoxy-5 indole carboxylate d'ethyle-2; Ethyl 5-methoxyindole-2-carboxylate |
الصيغة الجزيئية |
C12H13NO3 |
الوزن الجزيئي الغرامي |
219.2365 |
InChI |
InChI=1/C12H13NO3/c1-3-16-12(14)11-7-8-6-9(15-2)4-5-10(8)13-11/h4-7,13H,3H2,1-2H3 |
إستراتيجية المساعدة القطرية |
4792-58-9 |
بنية جزيئية |
|
كثافة |
1.216g/cm3 |
نقطة الغليان |
380.2°C at 760 mmHg |
معامل الإنكسار |
1.599 |
نقطة الوميض |
183.7°C |
ضغط البخار |
5.54E-06mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
|
شروط الأمن |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|