4946-14-9 p-isoPropyl Thiophenol
اسم المنتج |
p-isoPropyl Thiophenol |
الاسم بالانجليزية |
p-isoPropyl Thiophenol; 4-Isopropylthiophenol; 4-Isopropylbenzenethiol; 4-(propan-2-yl)benzenethiol; 4-(1-methylethyl)benzenethiolate; (4-Isopropyl)thiophenol |
الصيغة الجزيئية |
C9H11S |
الوزن الجزيئي الغرامي |
151.2492 |
InChI |
InChI=1/C9H12S/c1-7(2)8-3-5-9(10)6-4-8/h3-7,10H,1-2H3/p-1 |
إستراتيجية المساعدة القطرية |
4946-14-9 |
بنية جزيئية |
|
نقطة الغليان |
215.1°C at 760 mmHg |
نقطة الوميض |
86.4°C |
ضغط البخار |
0.22mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|