ChemNet > CAS > 5002-93-7 1-amino-3-(4-methoxyphenoxy)propan-2-ol
5002-93-7 1-amino-3-(4-methoxyphenoxy)propan-2-ol
اسم المنتج |
1-amino-3-(4-methoxyphenoxy)propan-2-ol |
الاسم بالانجليزية |
1-amino-3-(4-methoxyphenoxy)propan-2-ol; |
الصيغة الجزيئية |
C10H15NO3 |
الوزن الجزيئي الغرامي |
197.231 |
InChI |
InChI=1/C10H15NO3/c1-13-9-2-4-10(5-3-9)14-7-8(12)6-11/h2-5,8,12H,6-7,11H2,1H3 |
إستراتيجية المساعدة القطرية |
5002-93-7 |
بنية جزيئية |
|
كثافة |
1.146g/cm3 |
درجة الإنصهار |
110℃ |
نقطة الغليان |
368.8°C at 760 mmHg |
معامل الإنكسار |
1.539 |
نقطة الوميض |
176.9°C |
ضغط البخار |
4.33E-06mmHg at 25°C |
علامات على البضائع الخطرة |
C:Corrosive;
|
خطر المصطلحات |
R34:Causes burns.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|