ChemNet > CAS > 5081-42-5 Methyl 2-nitro-3,4,5-trimethoxybenzoate
5081-42-5 Methyl 2-nitro-3,4,5-trimethoxybenzoate
اسم المنتج |
Methyl 2-nitro-3,4,5-trimethoxybenzoate |
الاسم بالانجليزية |
Methyl 2-nitro-3,4,5-trimethoxybenzoate; 2-Nitro-3,4,5-trimethoxybenzoic acid methyl ester; methyl 3,4,5-trimethoxy-2-nitrobenzoate |
الصيغة الجزيئية |
C11H13NO7 |
الوزن الجزيئي الغرامي |
271.2234 |
InChI |
InChI=1/C11H13NO7/c1-16-7-5-6(11(13)19-4)8(12(14)15)10(18-3)9(7)17-2/h5H,1-4H3 |
إستراتيجية المساعدة القطرية |
5081-42-5 |
المفوضية الأوروبية رقم |
225-794-8 |
بنية جزيئية |
|
كثافة |
1.284g/cm3 |
نقطة الغليان |
420°C at 760 mmHg |
معامل الإنكسار |
1.523 |
نقطة الوميض |
188.9°C |
ضغط البخار |
2.9E-07mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
|
شروط الأمن |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|