ChemNet > CAS > 51628-12-7 4-Iodophenylacetonitrile
51628-12-7 4-Iodophenylacetonitrile
اسم المنتج |
4-Iodophenylacetonitrile |
الاسم بالانجليزية |
4-Iodophenylacetonitrile; 4-Iodobenzyl cyanide |
الصيغة الجزيئية |
C8H6IN |
الوزن الجزيئي الغرامي |
243.0444 |
InChI |
InChI=1/C8H6IN/c9-8-3-1-7(2-4-8)5-6-10/h1-4H,5H2 |
إستراتيجية المساعدة القطرية |
51628-12-7 |
بنية جزيئية |
|
كثافة |
1.764g/cm3 |
نقطة الغليان |
285.8°C at 760 mmHg |
معامل الإنكسار |
1.624 |
نقطة الوميض |
126.6°C |
ضغط البخار |
0.00275mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
شروط الأمن |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|