ChemNet > CAS > 52721-69-4 2-Fluorophenethylamine
52721-69-4 2-Fluorophenethylamine
| اسم المنتج |
2-Fluorophenethylamine |
| الاسم بالانجليزية |
2-Fluorophenethylamine; 2-(2-Fluorophenyl)-ethylamine; 2-(2-fluorophenyl)ethanamine; 2-(2-fluorophenyl)ethanaminium; 2-Fluoro-benzeneethanamine |
| الصيغة الجزيئية |
C8H11FN |
| الوزن الجزيئي الغرامي |
140.1775 |
| InChI |
InChI=1/C8H10FN/c9-8-4-2-1-3-7(8)5-6-10/h1-4H,5-6,10H2/p+1 |
| إستراتيجية المساعدة القطرية |
52721-69-4 |
| بنية جزيئية |
|
| نقطة الغليان |
242.8°C at 760 mmHg |
| نقطة الوميض |
77.2°C |
| ضغط البخار |
0.0333mmHg at 25°C |
| علامات على البضائع الخطرة |
 C:Corrosive;
|
| خطر المصطلحات |
R34:Causes burns.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
