ChemNet > CAS > 53760-27-3 4,4'-Diaminodiphenylamine sulfate
53760-27-3 4,4'-Diaminodiphenylamine sulfate
| اسم المنتج |
4,4'-Diaminodiphenylamine sulfate |
| الاسم بالانجليزية |
4,4'-Diaminodiphenylamine sulfate; 4,4-Diaminophenylamine sulfate; 4,4-Iminodianiline sulfate salt; N-(4-aminophenyl)benzene-1,4-diamine; N-(4-aminophenyl)benzene-1,4-diamine sulfate (1:1); N-(4-Aminophenyl)-1,4-benzenediamine |
| الصيغة الجزيئية |
C12H13N3O4S |
| الوزن الجزيئي الغرامي |
295.3154 |
| InChI |
InChI=1/C12H13N3.H2O4S/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12;1-5(2,3)4/h1-8,15H,13-14H2;(H2,1,2,3,4)/p-2 |
| إستراتيجية المساعدة القطرية |
53760-27-3 |
| المفوضية الأوروبية رقم |
258-748-0 |
| بنية جزيئية |
|
| درجة الإنصهار |
300℃ |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
|
| شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|
|
