ChemNet > CAS > 54629-13-9 2-(4-Fluorophenoxy)nicotinic acid
54629-13-9 2-(4-Fluorophenoxy)nicotinic acid
اسم المنتج |
2-(4-Fluorophenoxy)nicotinic acid |
الاسم بالانجليزية |
2-(4-Fluorophenoxy)nicotinic acid;2-(4-fluorophenoxy)pyridine-3-carboxylic acid; 2-(4-fluorophenoxy)pyridine-3-carboxylate |
الصيغة الجزيئية |
C12H7FNO3 |
الوزن الجزيئي الغرامي |
232.1878 |
InChI |
InChI=1/C12H8FNO3/c13-8-3-5-9(6-4-8)17-11-10(12(15)16)2-1-7-14-11/h1-7H,(H,15,16)/p-1 |
إستراتيجية المساعدة القطرية |
54629-13-9 |
بنية جزيئية |
|
درجة الإنصهار |
187-189℃ |
نقطة الغليان |
365.2°C at 760 mmHg |
نقطة الوميض |
174.7°C |
ضغط البخار |
5.63E-06mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
|
شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|
|