ChemNet > CAS > 56107-02-9 4-Chloro-3-nitrobenzophenone
56107-02-9 4-Chloro-3-nitrobenzophenone
| اسم المنتج |
4-Chloro-3-nitrobenzophenone |
| الاسم بالانجليزية |
4-Chloro-3-nitrobenzophenone; (4-Chloro-3-nitrophenyl)phenylmethanone |
| الصيغة الجزيئية |
C13H8ClNO3 |
| الوزن الجزيئي الغرامي |
261.6605 |
| InChI |
InChI=1/C13H8ClNO3/c14-11-7-6-10(8-12(11)15(17)18)13(16)9-4-2-1-3-5-9/h1-8H |
| إستراتيجية المساعدة القطرية |
56107-02-9 |
| المفوضية الأوروبية رقم |
259-995-7 |
| بنية جزيئية |
|
| كثافة |
1.367g/cm3 |
| درجة الإنصهار |
101-107℃ |
| نقطة الغليان |
386.5°C at 760 mmHg |
| معامل الإنكسار |
1.623 |
| نقطة الوميض |
203.4°C |
| ضغط البخار |
3.53E-06mmHg at 25°C |
| علامات على البضائع الخطرة |
 Xn:Harmful;
|
| خطر المصطلحات |
R20/21:Harmful by inhalation and in contact with skin.;
|
| شروط الأمن |
S22:Do not inhale dust.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
