ChemNet > CAS > 123333-92-6;56737-75-8 2,3-Dimethylphenylhydrazine hydrochloride
123333-92-6;56737-75-8 2,3-Dimethylphenylhydrazine hydrochloride
| اسم المنتج |
2,3-Dimethylphenylhydrazine hydrochloride |
| الاسم بالانجليزية |
2,3-Dimethylphenylhydrazine hydrochloride;(2,3-dimethylphenyl)diazanium chloride; (2,3-dimethylphenyl)hydrazine; (2,3-dimethylphenyl)hydrazine hydrochloride hydrate |
| الصيغة الجزيئية |
C8H15ClN2O |
| الوزن الجزيئي الغرامي |
190.6705 |
| InChI |
InChI=1/C8H12N2.ClH.H2O/c1-6-4-3-5-8(10-9)7(6)2;;/h3-5,10H,9H2,1-2H3;1H;1H2 |
| إستراتيجية المساعدة القطرية |
123333-92-6;56737-75-8 |
| بنية جزيئية |
|
| درجة الإنصهار |
210℃ |
| نقطة الغليان |
355°C at 760 mmHg |
| نقطة الوميض |
168.5°C |
| ضغط البخار |
1.18E-05mmHg at 25°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
