587-02-0 3-Ethylaniline
اسم المنتج |
3-Ethylaniline |
الاسم بالانجليزية |
3-Ethylaniline;3-Ethylbenzenamine; 3-Ethylphenylamine; 4-12-00-02417 (Beilstein Handbook Reference); BRN 0636282; m-Ethylaniline; Aniline, m-ethyl-; Benzenamine, 3-ethyl- (9CI) |
الصيغة الجزيئية |
C8H11N |
الوزن الجزيئي الغرامي |
121.1796 |
InChI |
InChI=1/C8H11N/c1-2-7-4-3-5-8(9)6-7/h3-6H,2,9H2,1H3 |
إستراتيجية المساعدة القطرية |
587-02-0 |
المفوضية الأوروبية رقم |
209-594-8 |
بنية جزيئية |
|
كثافة |
0.973g/cm3 |
درجة الإنصهار |
-8℃ |
نقطة الغليان |
216.6°C at 760 mmHg |
معامل الإنكسار |
1.556 |
نقطة الوميض |
85°C |
ضغط البخار |
0.139mmHg at 25°C |
علامات على البضائع الخطرة |
T:Toxic;
|
خطر المصطلحات |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
|
شروط الأمن |
S28A:After contact with skin, wash immediately with plenty of water.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|