ChemNet > CAS > 59-85-8 4-(chloromercurio)benzoic acid
59-85-8 4-(chloromercurio)benzoic acid
| اسم المنتج |
4-(chloromercurio)benzoic acid |
| الاسم بالانجليزية |
4-(chloromercurio)benzoic acid; 4-chloromercuriobenzoic acid; 4-Chloromercuribenzoic acid; (4-carboxyphenyl)(chloro)mercury; (4-carboxyphenyl)mercury(1+) chloride |
| الصيغة الجزيئية |
C7H5ClHgO2 |
| الوزن الجزيئي الغرامي |
357.1564 |
| InChI |
InChI=1/C7H5O2.ClH.Hg/c8-7(9)6-4-2-1-3-5-6;;/h2-5H,(H,8,9);1H;/q;;+1/p-1/rC7H5HgO2.ClH/c8-6-3-1-5(2-4-6)7(9)10;/h1-4H,(H,9,10);1H/q+1;/p-1 |
| إستراتيجية المساعدة القطرية |
59-85-8 |
| المفوضية الأوروبية رقم |
200-442-6 |
| بنية جزيئية |
|
| درجة الإنصهار |
300℃ |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R26/27/28:Very toxic by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
|
| شروط الأمن |
S13:Keep away from food, drink and animal feeding stuffs.;
S28:After contact with skin, wash immediately with plenty of ...;
S36:Wear suitable protective clothing.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
