ChemNet > CAS > 5916-12-1 2-Acetylthiophene ethylene acetal
5916-12-1 2-Acetylthiophene ethylene acetal
اسم المنتج |
2-Acetylthiophene ethylene acetal |
الاسم بالانجليزية |
2-Acetylthiophene ethylene acetal; 2-Methyl-2-(2-thienyl)-1,3-dioxolane; 2-methyl-2-thiophen-2-yl-1,3-dioxolane |
الصيغة الجزيئية |
C8H10O2S |
الوزن الجزيئي الغرامي |
170.2288 |
InChI |
InChI=1/C8H10O2S/c1-8(9-4-5-10-8)7-3-2-6-11-7/h2-3,6H,4-5H2,1H3 |
إستراتيجية المساعدة القطرية |
5916-12-1 |
بنية جزيئية |
|
كثافة |
1.191g/cm3 |
نقطة الغليان |
243.7°C at 760 mmHg |
معامل الإنكسار |
1.535 |
نقطة الوميض |
101.2°C |
ضغط البخار |
0.0495mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
شروط الأمن |
S36/37:Wear suitable protective clothing and gloves.;
|
|