611-15-4 o-Vinyltoluene
اسم المنتج |
o-Vinyltoluene |
الاسم بالانجليزية |
o-Vinyltoluene; 2-Methylstyrene; 2-Vinyltoluene |
الصيغة الجزيئية |
C9H10 |
الوزن الجزيئي الغرامي |
118.17 |
InChI |
InChI=1/C9H10/c1-3-9-7-5-4-6-8(9)2/h3-7H,1H2,2H3 |
إستراتيجية المساعدة القطرية |
611-15-4 |
المفوضية الأوروبية رقم |
210-256-7 |
بنية جزيئية |
|
كثافة |
0.916 |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R20:Harmful by inhalation.;
R51/53:Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.;
|
شروط الأمن |
S24:Avoid contact with skin.;
S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.;
|
|