613-13-8 2-Aminoanthracene
اسم المنتج |
2-Aminoanthracene |
الاسم بالانجليزية |
2-Aminoanthracene; 2-anthramine practical grade*crystalline; 2-anthrylamine; 2-Anthramine; 2-Anthranamine; anthracen-2-amine; 2-Anthracenamide;
|
الصيغة الجزيئية |
C14H11N |
الوزن الجزيئي الغرامي |
193.2438 |
InChI |
InChI=1/C14H11N/c15-14-6-5-12-7-10-3-1-2-4-11(10)8-13(12)9-14/h1-9H,15H2 |
إستراتيجية المساعدة القطرية |
613-13-8 |
المفوضية الأوروبية رقم |
210-330-9 |
بنية جزيئية |
|
كثافة |
1.208g/cm3 |
درجة الإنصهار |
238-241℃ |
نقطة الغليان |
414.2°C at 760 mmHg |
معامل الإنكسار |
1.765 |
نقطة الوميض |
229°C |
ضغط البخار |
4.52E-07mmHg at 25°C |
علامات على البضائع الخطرة |
Xn:Harmful;
|
خطر المصطلحات |
R33:Danger of cummulative effects.;
|
شروط الأمن |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|