ChemNet > CAS > 617-05-0 Vanilicacidethylester; 97%
617-05-0 Vanilicacidethylester; 97%
اسم المنتج |
Vanilicacidethylester; 97% |
الاسم بالانجليزية |
Vanilicacidethylester; 97%; Vanilic acid ethyl ester; Ethyl vanillate; Ethyl 4-hydroxy-3-methoxybenzoate~Vanillic acid ethyl ester; 4-Hydroxy-3-methoxybenzoic acid ethyl ester; ethyl 4-hydroxy-3-methoxybenzoate |
الصيغة الجزيئية |
C10H12O4 |
الوزن الجزيئي الغرامي |
196.1999 |
InChI |
InChI=1/C10H12O4/c1-3-14-10(12)7-4-5-8(11)9(6-7)13-2/h4-6,11H,3H2,1-2H3 |
إستراتيجية المساعدة القطرية |
617-05-0 |
المفوضية الأوروبية رقم |
210-503-9 |
بنية جزيئية |
|
كثافة |
1.18g/cm3 |
درجة الإنصهار |
39-41℃ |
نقطة الغليان |
292°C at 760 mmHg |
معامل الإنكسار |
1.528 |
نقطة الوميض |
122.4°C |
ضغط البخار |
0.00108mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
|
شروط الأمن |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|