ChemNet > CAS > 621-54-5 3-(3-Hydroxyphenyl)propionic acid
621-54-5 3-(3-Hydroxyphenyl)propionic acid
اسم المنتج |
3-(3-Hydroxyphenyl)propionic acid |
الاسم بالانجليزية |
3-(3-Hydroxyphenyl)propionic acid; 3-Hydroxyhydrocinnamic acid; 3-Hydroxyphenyl-propionic acid; 3-(3-hydroxyphenyl)propanoic acid |
الصيغة الجزيئية |
C9H10O3 |
الوزن الجزيئي الغرامي |
166.1739 |
InChI |
InChI=1/C9H10O3/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-3,6,10H,4-5H2,(H,11,12) |
إستراتيجية المساعدة القطرية |
621-54-5 |
المفوضية الأوروبية رقم |
210-692-8 |
بنية جزيئية |
|
كثافة |
1.26g/cm3 |
نقطة الغليان |
354.5°C at 760 mmHg |
معامل الإنكسار |
1.58 |
نقطة الوميض |
182.4°C |
ضغط البخار |
1.23E-05mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|