ChemNet > CAS > 62348-13-4 Isoxazole-5-carbonyl chloride
62348-13-4 Isoxazole-5-carbonyl chloride
| اسم المنتج |
Isoxazole-5-carbonyl chloride |
| الاسم بالانجليزية |
Isoxazole-5-carbonyl chloride; 5-Isoxazolecarboxylic acid chloride; Isoxazole-5-carbonychlordie |
| الصيغة الجزيئية |
C4H2ClNO2 |
| الوزن الجزيئي الغرامي |
131.5172 |
| InChI |
InChI=1/C4H2ClNO2/c5-4(7)3-1-2-6-8-3/h1-2H |
| إستراتيجية المساعدة القطرية |
62348-13-4 |
| بنية جزيئية |
|
| كثافة |
1.432g/cm3 |
| نقطة الغليان |
213.213°C at 760 mmHg |
| معامل الإنكسار |
1.497 |
| نقطة الوميض |
82.749°C |
| ضغط البخار |
0.166mmHg at 25°C |
| علامات على البضائع الخطرة |
 C:Corrosive;
|
| خطر المصطلحات |
R34:Causes burns.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
