ChemNet > CAS > 624-17-9 Diethyl azelate
624-17-9 Diethyl azelate
اسم المنتج |
Diethyl azelate |
الاسم بالانجليزية |
Diethyl azelate; Diethyl azelate, (Azelaic acid diethyl ester; Diethyl; Azelaic acid diethyl ester~Nonanedioic acid diethyl ester; diethyl nonanedioate |
الصيغة الجزيئية |
C13H24O4 |
الوزن الجزيئي الغرامي |
244.3273 |
InChI |
InChI=1/C13H24O4/c1-3-16-12(14)10-8-6-5-7-9-11-13(15)17-4-2/h3-11H2,1-2H3 |
إستراتيجية المساعدة القطرية |
624-17-9 |
المفوضية الأوروبية رقم |
210-833-3 |
بنية جزيئية |
|
كثافة |
0.976g/cm3 |
نقطة الغليان |
291.5°C at 760 mmHg |
معامل الإنكسار |
1.439 |
نقطة الوميض |
129.2°C |
ضغط البخار |
0.00194mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
|
شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|
|