626-27-7 Heptanoic anhydride
اسم المنتج |
Heptanoic anhydride |
الاسم بالانجليزية |
Heptanoic anhydride; Enanthicanhydride; Oenanthic anhydride; Enanthic anhydride |
الصيغة الجزيئية |
C14H26O3 |
الوزن الجزيئي الغرامي |
242.3544 |
InChI |
InChI=1/C14H26O3/c1-3-5-7-9-11-13(15)17-14(16)12-10-8-6-4-2/h3-12H2,1-2H3 |
إستراتيجية المساعدة القطرية |
626-27-7 |
المفوضية الأوروبية رقم |
210-940-5 |
بنية جزيئية |
|
كثافة |
0.931g/cm3 |
درجة الإنصهار |
-12℃ |
نقطة الغليان |
269.5°C at 760 mmHg |
معامل الإنكسار |
1.44 |
نقطة الوميض |
129.9°C |
ضغط البخار |
0.00723mmHg at 25°C |
علامات على البضائع الخطرة |
C:Corrosive;
|
خطر المصطلحات |
R34:Causes burns.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|