627-04-3 (Ethylthio)acetic acid
اسم المنتج |
(Ethylthio)acetic acid |
الاسم بالانجليزية |
(Ethylthio)acetic acid; S-Ethylthioglycolic acid; (ethylsulfanyl)acetic acid |
الصيغة الجزيئية |
C4H8O2S |
الوزن الجزيئي الغرامي |
120.1701 |
InChI |
InChI=1/C4H8O2S/c1-2-7-3-4(5)6/h2-3H2,1H3,(H,5,6) |
إستراتيجية المساعدة القطرية |
627-04-3 |
المفوضية الأوروبية رقم |
210-979-8 |
بنية جزيئية |
|
كثافة |
1.164g/cm3 |
نقطة الغليان |
229°C at 760 mmHg |
معامل الإنكسار |
1.496 |
نقطة الوميض |
92.3°C |
ضغط البخار |
0.0254mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R34:Causes burns.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|