6326-14-3 2,4-Dichlorophenylthiourae

اسم المنتج	2,4-Dichlorophenylthiourae
الاسم بالانجليزية	2,4-Dichlorophenylthiourae;
الصيغة الجزيئية	C₇H₆Cl₂N₂S
الوزن الجزيئي الغرامي	221.1069
InChI	InChI=1/C7H6Cl2N2S/c8-4-1-2-6(5(9)3-4)11-7(10)12/h1-3H,(H3,10,11,12)
إستراتيجية المساعدة القطرية	6326-14-3
بنية جزيئية
كثافة	1.563g/cm³
نقطة الغليان	321.8°C at 760 mmHg
معامل الإنكسار	1.73
نقطة الوميض	148.4°C
ضغط البخار	0.000292mmHg at 25°C
علامات على البضائع الخطرة
خطر المصطلحات	R20/22:Harmful by inhalation and if swallowed.;
شروط الأمن	S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.;