ChemNet > CAS > 6345-55-7 5-nitro-1-benzothiophene-2-carboxylic acid
6345-55-7 5-nitro-1-benzothiophene-2-carboxylic acid
اسم المنتج |
5-nitro-1-benzothiophene-2-carboxylic acid |
الاسم بالانجليزية |
5-nitro-1-benzothiophene-2-carboxylic acid;5-nitro-1-benzothiophene-2-carboxylate |
الصيغة الجزيئية |
C9H4NO4S |
الوزن الجزيئي الغرامي |
222.1979 |
InChI |
InChI=1/C9H5NO4S/c11-9(12)8-4-5-3-6(10(13)14)1-2-7(5)15-8/h1-4H,(H,11,12)/p-1 |
إستراتيجية المساعدة القطرية |
6345-55-7 |
بنية جزيئية |
|
درجة الإنصهار |
238℃ |
نقطة الغليان |
473.6°C at 760 mmHg |
نقطة الوميض |
240.2°C |
ضغط البخار |
8.93E-10mmHg at 25°C |
علامات على البضائع الخطرة |
Xi:Irritant;
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|