636-26-0 5-methyl-2-thiouracil
اسم المنتج |
5-methyl-2-thiouracil |
الاسم بالانجليزية |
5-methyl-2-thiouracil; 4-Hydroxy-2-mercapto-5-methylpyrimidine; 2-Thiothymine; 5-methyl-2-thioxo-2,3-dihydropyrimidin-4(1H)-one |
الصيغة الجزيئية |
C5H6N2OS |
الوزن الجزيئي الغرامي |
142.1789 |
InChI |
InChI=1/C5H6N2OS/c1-3-2-6-5(9)7-4(3)8/h2H,1H3,(H2,6,7,8,9) |
إستراتيجية المساعدة القطرية |
636-26-0 |
بنية جزيئية |
|
كثافة |
1.36g/cm3 |
درجة الإنصهار |
265-267℃ |
نقطة الغليان |
329.7°C at 760 mmHg |
معامل الإنكسار |
1.638 |
نقطة الوميض |
153.2°C |
ضغط البخار |
9.11E-05mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R22:Harmful if swallowed.;
R40:Possible risks of irreversible effects.;
|
شروط الأمن |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|