ChemNet > CAS > 64287-19-0 4-Fluoro-3-methoxyacetophenone
64287-19-0 4-Fluoro-3-methoxyacetophenone
اسم المنتج |
4-Fluoro-3-methoxyacetophenone |
الاسم بالانجليزية |
4-Fluoro-3-methoxyacetophenone; 1-(4-Fluoro-3-methoxyphenyl)ethanone; Ethanone, 2-amino-1-(2,4-difluorophenyl)-; 4'-Fluoro-3'-methoxyacetophenone |
الصيغة الجزيئية |
C8H7F2NO |
الوزن الجزيئي الغرامي |
171.1441 |
InChI |
InChI=1/C8H7F2NO/c9-5-1-2-6(7(10)3-5)8(12)4-11/h1-3H,4,11H2 |
إستراتيجية المساعدة القطرية |
64287-19-0 |
بنية جزيئية |
|
كثافة |
1.286g/cm3 |
نقطة الغليان |
255.9°C at 760 mmHg |
معامل الإنكسار |
1.51 |
نقطة الوميض |
108.6°C |
ضغط البخار |
0.0159mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|