ChemNet > CAS > 6609-54-7 2-(Methylthio)benzonitrile
6609-54-7 2-(Methylthio)benzonitrile
اسم المنتج |
2-(Methylthio)benzonitrile |
الاسم بالانجليزية |
2-(Methylthio)benzonitrile; 2-Cyanothioanisole~2-(Methylmercapto)benzonitrile; 2-(methylsulfanyl)benzonitrile |
الصيغة الجزيئية |
C8H7NS |
الوزن الجزيئي الغرامي |
149.2129 |
InChI |
InChI=1/C8H7NS/c1-10-8-5-3-2-4-7(8)6-9/h2-5H,1H3 |
إستراتيجية المساعدة القطرية |
6609-54-7 |
بنية جزيئية |
|
كثافة |
1.14g/cm3 |
نقطة الغليان |
263.9°C at 760 mmHg |
معامل الإنكسار |
1.589 |
نقطة الوميض |
113.4°C |
ضغط البخار |
0.00999mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
شروط الأمن |
S36/37:Wear suitable protective clothing and gloves.;
|
|