ChemNet > CAS > 6705-03-9 2-Amino-5-methoxybenzoic acid
6705-03-9 2-Amino-5-methoxybenzoic acid
اسم المنتج |
2-Amino-5-methoxybenzoic acid |
الاسم بالانجليزية |
2-Amino-5-methoxybenzoic acid; 5-Methoxyanthranilic acid; 2-Amino-5-methoxy-benzoic acid |
الصيغة الجزيئية |
C8H8N2O |
الوزن الجزيئي الغرامي |
148.1619 |
InChI |
InChI=1/C8H8N2O/c1-11-7-2-3-8(10)6(4-7)5-9/h2-4H,10H2,1H3 |
إستراتيجية المساعدة القطرية |
6705-03-9 |
بنية جزيئية |
|
كثافة |
1.17g/cm3 |
درجة الإنصهار |
148-152℃ |
نقطة الغليان |
302.2°C at 760 mmHg |
معامل الإنكسار |
1.569 |
نقطة الوميض |
136.6°C |
ضغط البخار |
0.00101mmHg at 25°C |
علامات على البضائع الخطرة |
Xn:Harmful;
|
خطر المصطلحات |
R22:;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|