ChemNet > CAS > 6760-14-1 2-Amino-5-nitronicotinic acid
6760-14-1 2-Amino-5-nitronicotinic acid
اسم المنتج |
2-Amino-5-nitronicotinic acid |
الاسم بالانجليزية |
2-Amino-5-nitronicotinic acid; 2-amino-5-nitropyridine-3-carboxylic acid |
الصيغة الجزيئية |
C6H5N3O4 |
الوزن الجزيئي الغرامي |
183.1216 |
InChI |
InChI=1/C6H5N3O4/c7-5-4(6(10)11)1-3(2-8-5)9(12)13/h1-2H,(H2,7,8)(H,10,11) |
إستراتيجية المساعدة القطرية |
6760-14-1 |
بنية جزيئية |
|
كثافة |
1.675g/cm3 |
نقطة الغليان |
457.4°C at 760 mmHg |
معامل الإنكسار |
1.695 |
نقطة الوميض |
230.4°C |
ضغط البخار |
3.68E-09mmHg at 25°C |
علامات على البضائع الخطرة |
Xi:Irritant;
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|