ChemNet > CAS > 71902-33-5 3,5-Difluoropyridine
71902-33-5 3,5-Difluoropyridine
| اسم المنتج |
3,5-Difluoropyridine |
| الاسم بالانجليزية |
3,5-Difluoropyridine; |
| الصيغة الجزيئية |
C5H3F2N |
| الوزن الجزيئي الغرامي |
115.0808 |
| InChI |
InChI=1/C5H3F2N/c6-4-1-5(7)3-8-2-4/h1-3H |
| إستراتيجية المساعدة القطرية |
71902-33-5 |
| بنية جزيئية |
|
| كثافة |
1.263g/cm3 |
| نقطة الغليان |
79.4°C at 760 mmHg |
| معامل الإنكسار |
1.446 |
| نقطة الوميض |
1.9°C |
| ضغط البخار |
98.5mmHg at 25°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R11:Highly flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
