ChemNet > CAS > 72065-23-7 N-Acryloylsarcosine methyl ester
72065-23-7 N-Acryloylsarcosine methyl ester
| اسم المنتج |
N-Acryloylsarcosine methyl ester |
| الاسم بالانجليزية |
N-Acryloylsarcosine methyl ester;methyl N-acryloyl-N-methylglycinate |
| الصيغة الجزيئية |
C7H11NO3 |
| الوزن الجزيئي الغرامي |
157.1671 |
| InChI |
InChI=1/C7H11NO3/c1-4-6(9)8(2)5-7(10)11-3/h4H,1,5H2,2-3H3 |
| إستراتيجية المساعدة القطرية |
72065-23-7 |
| بنية جزيئية |
|
| كثافة |
1.068g/cm3 |
| نقطة الغليان |
276.3°C at 760 mmHg |
| معامل الإنكسار |
1.452 |
| نقطة الوميض |
120.9°C |
| ضغط البخار |
0.00485mmHg at 25°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R36/38:Irritating to eyes and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
