ChemNet > CAS > 7472-43-7 6-Benzoylhexanoic acid
7472-43-7 6-Benzoylhexanoic acid
اسم المنتج |
6-Benzoylhexanoic acid |
الاسم بالانجليزية |
6-Benzoylhexanoic acid; 7-Oxo-7-phenylheptanoic acid; 7-Oxo-7-phenyl-heptanoic acid; 6-Benzoyl hexanoic Acid |
الصيغة الجزيئية |
C13H16O3 |
الوزن الجزيئي الغرامي |
220.2643 |
InChI |
InChI=1/C13H16O3/c14-12(11-7-3-1-4-8-11)9-5-2-6-10-13(15)16/h1,3-4,7-8H,2,5-6,9-10H2,(H,15,16) |
إستراتيجية المساعدة القطرية |
7472-43-7 |
بنية جزيئية |
|
كثافة |
1.111g/cm3 |
نقطة الغليان |
396°C at 760 mmHg |
معامل الإنكسار |
1.528 |
نقطة الوميض |
207.4°C |
ضغط البخار |
5.57E-07mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|