75898-90-7 Inamrinone lactate
اسم المنتج |
Inamrinone lactate |
الاسم بالانجليزية |
Inamrinone lactate; 3-Hydroxypropanoic acid compd. with 5-amino-(3,4'-bipyridin)-6(1H)-one; Amrinone lactate; UNII-I229274Y5B; (3,4'-Bipyridin)-6(1H)-one, 5-amino-, 3-hydroxypropanoate; Propanoic acid, 3-hydroxy-, compd. with 5-amino-(3,4'-bipyridin)-6(1H)-one; 3-hydroxypropanoic acid - 5-amino-3,4'-bipyridin-6(1H)-one (1:1); 2-hydroxypropanoic acid - 5-amino-3,4'-bipyridin-6(1H)-one (1:1) |
الصيغة الجزيئية |
C13H15N3O4 |
الوزن الجزيئي الغرامي |
277.2759 |
InChI |
InChI=1/C10H9N3O.C3H6O3/c11-9-5-8(6-13-10(9)14)7-1-3-12-4-2-7;1-2(4)3(5)6/h1-6H,11H2,(H,13,14);2,4H,1H3,(H,5,6) |
إستراتيجية المساعدة القطرية |
75898-90-7 |
بنية جزيئية |
|
نقطة الغليان |
451.5°C at 760 mmHg |
نقطة الوميض |
226.9°C |
ضغط البخار |
2.42E-08mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
|
شروط الأمن |
|
|