ChemNet > CAS > 766-77-8 Phenyldimethylsilane
766-77-8 Phenyldimethylsilane
اسم المنتج |
Phenyldimethylsilane |
الاسم بالانجليزية |
Phenyldimethylsilane; Dimethylphenylsilane; dimethyl(phenyl)silyl |
الصيغة الجزيئية |
C8H11Si |
الوزن الجزيئي الغرامي |
135.2584 |
InChI |
InChI=1/C8H11Si/c1-9(2)8-6-4-3-5-7-8/h3-7H,1-2H3 |
إستراتيجية المساعدة القطرية |
766-77-8 |
المفوضية الأوروبية رقم |
212-170-5 |
بنية جزيئية |
|
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R10:Flammable.;
|
شروط الأمن |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|