ChemNet > CAS > 79-35-6 1,1-dichloro-2,2-difluoroethylene
79-35-6 1,1-dichloro-2,2-difluoroethylene
| اسم المنتج |
1,1-dichloro-2,2-difluoroethylene |
| الاسم بالانجليزية |
1,1-dichloro-2,2-difluoroethylene; FC-1112a; 1-chloro-1,2,2-trifluoroethene |
| الصيغة الجزيئية |
C2Cl2F2 |
| الوزن الجزيئي الغرامي |
132.9242 |
| InChI |
InChI=1/C2Cl2F2/c3-1(4)2(5)6 |
| إستراتيجية المساعدة القطرية |
79-35-6 |
| المفوضية الأوروبية رقم |
201-198-3 |
| بنية جزيئية |
|
| كثافة |
1.503g/cm3 |
| نقطة الغليان |
17.3°C at 760 mmHg |
| معامل الإنكسار |
1.392 |
| ضغط البخار |
999mmHg at 25°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R23:Toxic by inhalation.;
R36/38:Irritating to eyes and skin.;
|
| شروط الأمن |
S23:Do not inhale gas/fumes/vapour/spray.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S9:Keep container in a well-ventilated place.;
|
|
