ChemNet > CAS > 80500-27-2 4-Methyl-3-nitrobenzeneboronic acid
80500-27-2 4-Methyl-3-nitrobenzeneboronic acid
اسم المنتج |
4-Methyl-3-nitrobenzeneboronic acid |
الاسم بالانجليزية |
4-Methyl-3-nitrobenzeneboronic acid; 4-Methyl-3-nitrophenylboronic acid; 3-Nitro-p-tolylboronic acid; (4-methyl-3-nitrophenyl)boronic acid; 4-methyl-3-nitrophenylboronic acid; 3-Nitropheny-4-methylphenylboronic acid |
الصيغة الجزيئية |
C7H8BNO4 |
الوزن الجزيئي الغرامي |
180.9537 |
InChI |
InChI=1/C7H8BNO4/c1-5-2-3-6(8(10)11)4-7(5)9(12)13/h2-4,10-11H,1H3 |
إستراتيجية المساعدة القطرية |
80500-27-2 |
بنية جزيئية |
|
كثافة |
1.33g/cm3 |
درجة الإنصهار |
265-270 °C(lit.) |
نقطة الغليان |
356.7°C at 760 mmHg |
معامل الإنكسار |
1.563 |
نقطة الوميض |
169.5°C |
ضغط البخار |
1.05E-05mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|