ChemNet > CAS > 817-09-4 Tris(2-chloroethyl)amine hydrochloride
817-09-4 Tris(2-chloroethyl)amine hydrochloride
| اسم المنتج |
Tris(2-chloroethyl)amine hydrochloride |
| الاسم بالانجليزية |
Tris(2-chloroethyl)amine hydrochloride; 2,2,2-Trichlorotriethylamine hydrochloride; 2-chloro-N,N-bis(2-chloroethyl)ethanaminium; Tris-(2-chloroethyl)amine hydrochloride |
| الصيغة الجزيئية |
C6H13Cl3N |
| الوزن الجزيئي الغرامي |
205.5326 |
| InChI |
InChI=1/C6H12Cl3N/c7-1-4-10(5-2-8)6-3-9/h1-6H2/p+1 |
| إستراتيجية المساعدة القطرية |
817-09-4 |
| المفوضية الأوروبية رقم |
212-442-3 |
| بنية جزيئية |
|
| درجة الإنصهار |
127-132℃ |
| نقطة الغليان |
156.2°C at 760 mmHg |
| نقطة الوميض |
48.3°C |
| ضغط البخار |
2.92mmHg at 25°C |
| علامات على البضائع الخطرة |
 T+:Very toxic;
|
| خطر المصطلحات |
R26/27/28:Very toxic by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
R40:Possible risks of irreversible effects.;
|
| شروط الأمن |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
