ChemNet > CAS > 818-88-2 mono-methyl sebacate
818-88-2 mono-methyl sebacate
| اسم المنتج |
mono-methyl sebacate |
| الاسم بالانجليزية |
mono-methyl sebacate; Monomethyl sebacate~Sebacic acid monomethyl ester; Sebacic acid monomethyl ester; Methyl hydrogen sebacate (Monomethyl sebacate; Sebacic acid monomethyl ester); monomethyl sebacate; 10-methoxy-10-oxodecanoic acid |
| الصيغة الجزيئية |
C11H20O4 |
| الوزن الجزيئي الغرامي |
216.2741 |
| InChI |
InChI=1/C11H20O4/c1-15-11(14)9-7-5-3-2-4-6-8-10(12)13/h2-9H2,1H3,(H,12,13) |
| إستراتيجية المساعدة القطرية |
818-88-2 |
| المفوضية الأوروبية رقم |
212-458-0 |
| بنية جزيئية |
|
| كثافة |
1.038g/cm3 |
| درجة الإنصهار |
41-44℃ |
| نقطة الغليان |
332.5°C at 760 mmHg |
| معامل الإنكسار |
1.453 |
| نقطة الوميض |
115.4°C |
| ضغط البخار |
2.8E-05mmHg at 25°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
|
| شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|
|
