ChemNet > CAS > 85507-79-5 diundecyl phthalate, branched and linear
85507-79-5 diundecyl phthalate, branched and linear
اسم المنتج |
diundecyl phthalate, branched and linear |
الاسم بالانجليزية |
diundecyl phthalate, branched and linear; 1,2-Benzenedicarboxylic acid, 1,2-diundecyl ester, branched and linear; 1,2-Benzenedicarboxylic acid, diundecyl ester, branched and linear; Diundecyl phthalate, branched and linear; dodecyl (2R,3S)-3-ethyl-2-propylhexyl benzene-1,2-dicarboxylate; DUP |
الصيغة الجزيئية |
C31H52O4 |
الوزن الجزيئي الغرامي |
488.7422 |
InChI |
InChI=1/C31H52O4/c1-5-9-10-11-12-13-14-15-16-19-24-34-30(32)28-22-17-18-23-29(28)31(33)35-25-27(21-7-3)26(8-4)20-6-2/h17-18,22-23,26-27H,5-16,19-21,24-25H2,1-4H3/t26-,27-/m0/s1 |
إستراتيجية المساعدة القطرية |
85507-79-5 |
المفوضية الأوروبية رقم |
287-401-6 |
بنية جزيئية |
|
كثافة |
0.953g/cm3 |
نقطة الغليان |
455°C at 760 mmHg |
معامل الإنكسار |
1.485 |
نقطة الوميض |
244.1°C |
ضغط البخار |
1.82E-08mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
|
شروط الأمن |
|
|