ChemNet > CAS > 86010-32-4 5-nitro-1-benzothiophene-2-carbonyl chloride
86010-32-4 5-nitro-1-benzothiophene-2-carbonyl chloride
اسم المنتج |
5-nitro-1-benzothiophene-2-carbonyl chloride |
الاسم بالانجليزية |
5-nitro-1-benzothiophene-2-carbonyl chloride; |
الصيغة الجزيئية |
C9H4ClNO3S |
الوزن الجزيئي الغرامي |
241.651 |
InChI |
InChI=1/C9H4ClNO3S/c10-9(12)8-4-5-3-6(11(13)14)1-2-7(5)15-8/h1-4H |
إستراتيجية المساعدة القطرية |
86010-32-4 |
بنية جزيئية |
|
كثافة |
1.597g/cm3 |
درجة الإنصهار |
158℃ |
نقطة الغليان |
401.7°C at 760 mmHg |
معامل الإنكسار |
1.712 |
نقطة الوميض |
196.7°C |
ضغط البخار |
1.16E-06mmHg at 25°C |
علامات على البضائع الخطرة |
C:Corrosive;
|
خطر المصطلحات |
R34:Causes burns.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|