ChemNet > CAS > 869-29-4 Allylidenediacetate
869-29-4 Allylidenediacetate
| اسم المنتج |
Allylidenediacetate |
| الاسم بالانجليزية |
Allylidenediacetate; 212-789-0; prop-1-ene-3,3-diyl diacetate |
| الصيغة الجزيئية |
C7H10O4 |
| الوزن الجزيئي الغرامي |
158.1519 |
| InChI |
InChI=1/C7H10O4/c1-4-7(10-5(2)8)11-6(3)9/h4,7H,1H2,2-3H3 |
| إستراتيجية المساعدة القطرية |
869-29-4 |
| المفوضية الأوروبية رقم |
212-789-0 |
| بنية جزيئية |
|
| كثافة |
1.079g/cm3 |
| نقطة الغليان |
180°C at 760 mmHg |
| معامل الإنكسار |
1.428 |
| نقطة الوميض |
78.3°C |
| ضغط البخار |
0.915mmHg at 25°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
