9003-53-6 Poly(styrene)
اسم المنتج |
Poly(styrene) |
الاسم بالانجليزية |
Poly(styrene); Polystyrene; polystyrene standard 4000000; polystyrene standard 2000000; polystyrene standard 300000; polystyrene standard 1000000; polystyrene standard 700000; polystyrene standard 650000; polystyrene standard 2200000 certi-fied acc. to din; polystyrene standard 500000; polystyrene standard 8000000; Polystyrene (General Purpose Grade); Polystyrene, dicarboxy terminated; Polystyrene, methacrylate terminated solution; Styrene Resin (High M.Wt.); Styrene Latex; Styrene Resin (Low M.Wt.); Styrene Resin (Med.M.Wt.); Styrene-divinylbenzene copolymer (20% cross-linked); Polystyrene2% crosslinked with vinylbenzene; EPS; Expandable Polystyrene |
الصيغة الجزيئية |
C8H8 |
الوزن الجزيئي الغرامي |
104.1491 |
InChI |
InChI=1/C9H8/c1-8(2)9-6-4-3-5-7-9/h1-8H |
إستراتيجية المساعدة القطرية |
9003-53-6 |
بنية جزيئية |
|
كثافة |
1.047 |
نقطة الغليان |
212℃ |
معامل الإنكسار |
1.5916 |
الذوبان في الماء |
insoluble |
علامات على البضائع الخطرة |
Xi:;
|
خطر المصطلحات |
41:;
|
شروط الأمن |
S24/25:;
|
|