9009-54-5 Polyurethane
اسم المنتج |
Polyurethane |
الاسم بالانجليزية |
Polyurethane; Polyurethane foam; Polyurethane foams; Polyisocyanurate resins; Polyurethanes, cellular; PU foam; The following companies react isocyanates or prepolymers with polyols to produce polyurethane foams. The list is incomplete.; POLYURETHANEOLIGOMERS; POLYURETHANEVARNISH; PU; Acrylic polyurethane paint; Acrylic polyurethane anticorrosive coating; Polyurethane mixed component; 1-ethylurea |
الصيغة الجزيئية |
C3H8N2O |
الوزن الجزيئي الغرامي |
88.1084 |
InChI |
InChI=1/C3H8N2O/c1-2-5-3(4)6/h2H2,1H3,(H3,4,5,6) |
إستراتيجية المساعدة القطرية |
9009-54-5 |
المفوضية الأوروبية رقم |
210-898-8 |
بنية جزيئية |
|
كثافة |
1.005g/cm3 |
نقطة الغليان |
136.3°C at 760 mmHg |
معامل الإنكسار |
1.44 |
نقطة الوميض |
36.2°C |
ضغط البخار |
7.44mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
|
شروط الأمن |
|
|