ChemNet > CAS > 921-53-9 L(+)tartaric acid dipotassium
921-53-9 L(+)tartaric acid dipotassium
اسم المنتج |
L(+)tartaric acid dipotassium |
الاسم بالانجليزية |
L(+)tartaric acid dipotassium; dipotassium tartrate; L-Tartaric acid dipotassium salt; potassium tartrate |
الصيغة الجزيئية |
K2C4H4O6 |
الوزن الجزيئي الغرامي |
226.266 |
InChI |
InChI=1/C4H6O6.2K/c5-1(3(7)8)2(6)4(9)10;;/h1-2,5-6H,(H,7,8)(H,9,10);;/q;2*+1/p-2/t1-,2-;;/m1../s1 |
إستراتيجية المساعدة القطرية |
921-53-9 |
المفوضية الأوروبية رقم |
213-067-8 |
بنية جزيئية |
|
كثافة |
1.98 |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
|
شروط الأمن |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|