ChemNet > CAS > 931-17-9 1,2-Cyclohexanediol, mixture of cis and trans
931-17-9 1,2-Cyclohexanediol, mixture of cis and trans
| اسم المنتج |
1,2-Cyclohexanediol, mixture of cis and trans |
| الاسم بالانجليزية |
1,2-Cyclohexanediol, mixture of cis and trans; 1,2-Cyclohexanediol, cis/trans-mix; 1,2-Cyclohexanediol; 1,2-Cyclohexandiol |
| الصيغة الجزيئية |
C6H12O2 |
| الوزن الجزيئي الغرامي |
116.16 |
| InChI |
InChI=1/C6H12O2/c7-5-3-1-2-4-6(5)8/h5-8H,1-4H2 |
| إستراتيجية المساعدة القطرية |
931-17-9 |
| المفوضية الأوروبية رقم |
213-229-8 |
| بنية جزيئية |
|
| درجة الإنصهار |
73-77℃ |
| نقطة الغليان |
118-120℃ (10 mmHg) |
| الذوبان في الماء |
soluble |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
|
| شروط الأمن |
S23:;
S24/25:;
|
|
