ChemNet > CAS > 937-00-8 3-(trifluoromethyl)thiophenol
937-00-8 3-(trifluoromethyl)thiophenol
| اسم المنتج |
3-(trifluoromethyl)thiophenol |
| الاسم بالانجليزية |
3-(trifluoromethyl)thiophenol; 3-(Trifluoromethyl)benzenethiol; 1-bromo-5-chloro-2-fluoro-4-methylbenzene; 3-Trifluoromethyl thiophenol |
| الصيغة الجزيئية |
C7H5BrClF |
| الوزن الجزيئي الغرامي |
223.47 |
| InChI |
InChI=1/C7H5BrClF/c1-4-2-7(10)5(8)3-6(4)9/h2-3H,1H3 |
| إستراتيجية المساعدة القطرية |
937-00-8 |
| بنية جزيئية |
|
| كثافة |
1.618g/cm3 |
| نقطة الغليان |
221.1°C at 760 mmHg |
| معامل الإنكسار |
1.545 |
| نقطة الوميض |
87.5°C |
| ضغط البخار |
0.162mmHg at 25°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
