96-20-8 (±)-2-Amino-1-butanol
اسم المنتج |
(±)-2-Amino-1-butanol |
الاسم بالانجليزية |
(±)-2-Amino-1-butanol; (-)-2-Aminobutanol; .+/-.-2-Amino-1-butanol; 1-butanol, 2-amino-; 2-Aminobutan-1-ol; 2-Amino-1-butanol; 2-aminobutan-2-ol; 2-Amino-1-butanol |
الصيغة الجزيئية |
C4H12NO |
الوزن الجزيئي الغرامي |
90.1436 |
InChI |
InChI=1/C4H11NO/c1-2-4(5)3-6/h4,6H,2-3,5H2,1H3/p+1/t4-/m1/s1 |
إستراتيجية المساعدة القطرية |
96-20-8 |
المفوضية الأوروبية رقم |
202-488-2 |
بنية جزيئية |
|
درجة الإنصهار |
-2℃ |
نقطة الغليان |
177.2°C at 760 mmHg |
نقطة الوميض |
82.2°C |
ضغط البخار |
0.319mmHg at 25°C |
علامات على البضائع الخطرة |
C:Corrosive;
|
خطر المصطلحات |
R34:Causes burns.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|