ChemNet > CAS > 97914-59-5 2-(Difluoromethoxy)benzoic acid
97914-59-5 2-(Difluoromethoxy)benzoic acid
اسم المنتج |
2-(Difluoromethoxy)benzoic acid |
الاسم بالانجليزية |
2-(Difluoromethoxy)benzoic acid; 2-(Difluorometoxy)benzoic acid; 2-(difluoromethoxy)benzoate |
الصيغة الجزيئية |
C8H6F2O3 |
الوزن الجزيئي الغرامي |
188.1282 |
InChI |
InChI=1/C8H6F2O3/c9-8(10)13-6-4-2-1-3-5(6)7(11)12/h1-4,8H,(H,11,12) |
إستراتيجية المساعدة القطرية |
97914-59-5 |
بنية جزيئية |
|
كثافة |
1.37g/cm3 |
نقطة الغليان |
273.6°C at 760 mmHg |
معامل الإنكسار |
1.496 |
نقطة الوميض |
119.3°C |
ضغط البخار |
0.00276mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|