ChemNet > CAS > 99-42-3 Methyl 4-hydroxy-3-nitrobenzoate
99-42-3 Methyl 4-hydroxy-3-nitrobenzoate
اسم المنتج |
Methyl 4-hydroxy-3-nitrobenzoate |
الاسم بالانجليزية |
Methyl 4-hydroxy-3-nitrobenzoate; 4-Hydroxy-3-nitrobenzoic acid methyl ester; Methyl 3-nitro-4-hydroxybenzoate; 4-(methoxycarbonyl)-2-nitrophenolate; 3-nitro-4-hydroxymethyl benzoate |
الصيغة الجزيئية |
C8H6NO5 |
الوزن الجزيئي الغرامي |
196.1375 |
InChI |
InChI=1/C8H7NO5/c1-14-8(11)5-2-3-7(10)6(4-5)9(12)13/h2-4,10H,1H3/p-1 |
إستراتيجية المساعدة القطرية |
99-42-3 |
المفوضية الأوروبية رقم |
202-755-3 |
بنية جزيئية |
|
درجة الإنصهار |
74-76℃ |
نقطة الغليان |
311.1°C at 760 mmHg |
نقطة الوميض |
141.9°C |
ضغط البخار |
0.000315mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|