998-29-8 Tri-n-propylsilane
اسم المنتج |
Tri-n-propylsilane |
الاسم بالانجليزية |
Tri-n-propylsilane; Silane, tripropyl-; NSC 96837; Tripropylsilane; tripropylsilyl |
الصيغة الجزيئية |
C9H21Si |
الوزن الجزيئي الغرامي |
157.3485 |
InChI |
InChI=1/C9H21Si/c1-4-7-10(8-5-2)9-6-3/h4-9H2,1-3H3 |
إستراتيجية المساعدة القطرية |
998-29-8 |
المفوضية الأوروبية رقم |
213-649-1 |
بنية جزيئية |
|
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|